About (4-phenylphenyl)methyl 2,2,2-trifluoroacetate
(4-phenylphenyl)methyl 2,2,2-trifluoroacetate (PubChem CID 154709903) has the molecular formula C15H11F3O2
and a molecular weight of 280.25 g/mol. Its IUPAC name is (4-phenylphenyl)methyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | (4-phenylphenyl)methyl 2,2,2-trifluoroacetate |
| PubChem CID | 154709903 |
| Molecular Formula | C15H11F3O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (4-phenylphenyl)methyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCc1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H11F3O2/c16-15(17,18)14(19)20-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | AXVSOJBPJBWNHI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-phenylphenyl)methyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl)methyl 2,2,2-trifluoroacetate?
The IUPAC name of (4-phenylphenyl)methyl 2,2,2-trifluoroacetate (CID 154709903) is (4-phenylphenyl)methyl 2,2,2-trifluoroacetate.
What is the SMILES notation for (4-phenylphenyl)methyl 2,2,2-trifluoroacetate?
The canonical SMILES for (4-phenylphenyl)methyl 2,2,2-trifluoroacetate is O=C(OCc1ccc(-c2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of (4-phenylphenyl)methyl 2,2,2-trifluoroacetate?
The InChIKey is AXVSOJBPJBWNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3O2/c16-15(17,18)14(19)20-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2.
What are the key properties of (4-phenylphenyl)methyl 2,2,2-trifluoroacetate?
(4-phenylphenyl)methyl 2,2,2-trifluoroacetate has a molecular weight of 280.25 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl)methyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 154709903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).