C12H10 — CID 154710184
1-(1,2,2-trideuterioethenyl)naphthalene (PubChem CID 154710184) has the molecular formula C12H10 and a molecular weight of 157.23 g/mol. Its IUPAC name is 1-(1,2,2-trideuterioethenyl)naphthalene.
| Compound Name | 1-(1,2,2-trideuterioethenyl)naphthalene |
|---|---|
| PubChem CID | 154710184 |
| Molecular Formula | C12H10 |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 1-(1,2,2-trideuterioethenyl)naphthalene |
| SMILES | [2H]C([2H])=C([2H])c1cccc2ccccc12 |
| InChI | InChI=1S/C12H10/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h2-9H,1H2/i1D2,2D |
| InChIKey | IGGDKDTUCAWDAN-FUDHJZNOSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |