C21H15BFNO2 — CID 154710370
[(2S)-2-fluoro-3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-2-yl]-(4-methylphenyl)methanone (PubChem CID 154710370) has the molecular formula C21H15BFNO2 and a molecular weight of 343.17 g/mol. Its IUPAC name is [(2S)-2-fluoro-3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [(2S)-2-fluoro-3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 154710370 |
| Molecular Formula | C21H15BFNO2 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [(2S)-2-fluoro-3-oxa-1-azonia-2-boranuidatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4,6,8(16),9,11(15),12-heptaen-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[B@@-]2(F)Oc3cccc4ccc5ccc[n+]2c5c34)cc1 |
| InChI | InChI=1S/C21H15BFNO2/c1-14-7-9-17(10-8-14)21(25)22(23)24-13-3-5-16-12-11-15-4-2-6-18(26-22)19(15)20(16)24/h2-13H,1H3/t22-/m0/s1 |
| InChIKey | LVRMGPQXTMWHHW-QFIPXVFZSA-N |
| XLogP | 4.16 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|