About methyl 2-trimethylsilyltetradeca-2,3,13-trienoate
methyl 2-trimethylsilyltetradeca-2,3,13-trienoate (PubChem CID 154710374) has the molecular formula C18H32O2Si
and a molecular weight of 308.54 g/mol. Its IUPAC name is methyl 2-trimethylsilyltetradeca-2,3,13-trienoate.
Molecular Properties
| Compound Name | methyl 2-trimethylsilyltetradeca-2,3,13-trienoate |
| PubChem CID | 154710374 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | methyl 2-trimethylsilyltetradeca-2,3,13-trienoate |
| SMILES | C=CCCCCCCCCC=C=C(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C18H32O2Si/c1-6-7-8-9-10-11-12-13-14-15-16-17(18(19)20-2)21(3,4)5/h6,15H,1,7-14H2,2-5H3 |
| InChIKey | CSKHDZIOLNNZKX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-trimethylsilyltetradeca-2,3,13-trienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-trimethylsilyltetradeca-2,3,13-trienoate?
The IUPAC name of methyl 2-trimethylsilyltetradeca-2,3,13-trienoate (CID 154710374) is methyl 2-trimethylsilyltetradeca-2,3,13-trienoate.
What is the SMILES notation for methyl 2-trimethylsilyltetradeca-2,3,13-trienoate?
The canonical SMILES for methyl 2-trimethylsilyltetradeca-2,3,13-trienoate is C=CCCCCCCCCC=C=C(C(=O)OC)[Si](C)(C)C.
What is the InChIKey of methyl 2-trimethylsilyltetradeca-2,3,13-trienoate?
The InChIKey is CSKHDZIOLNNZKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2Si/c1-6-7-8-9-10-11-12-13-14-15-16-17(18(19)20-2)21(3,4)5/h6,15H,1,7-14H2,2-5H3.
What are the key properties of methyl 2-trimethylsilyltetradeca-2,3,13-trienoate?
methyl 2-trimethylsilyltetradeca-2,3,13-trienoate has a molecular weight of 308.54 g/mol, XLogP of 5.43, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-trimethylsilyltetradeca-2,3,13-trienoate is sourced from PubChem (CID 154710374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).