About 1,3-ditert-butyl-1,3,2λ2-diazastannole
1,3-ditert-butyl-1,3,2λ2-diazastannole (PubChem CID 154710402) has the molecular formula C10H20N2Sn
and a molecular weight of 287.00 g/mol. Its IUPAC name is 1,3-ditert-butyl-1,3,2λ2-diazastannole.
Molecular Properties
| Compound Name | 1,3-ditert-butyl-1,3,2λ2-diazastannole |
| PubChem CID | 154710402 |
| Molecular Formula | C10H20N2Sn |
| Molecular Weight | 287.00 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1,3-ditert-butyl-1,3,2λ2-diazastannole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[Sn]1 |
| InChI | InChI=1S/C10H20N2.Sn/c1-9(2,3)11-7-8-12-10(4,5)6;/h7-8H,1-6H3;/q-2;+2/b8-7-; |
| InChIKey | GMFXUCQSNQGPJG-CFYXSCKTSA-N |
| XLogP | 2.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-ditert-butyl-1,3,2λ2-diazastannole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-ditert-butyl-1,3,2λ2-diazastannole?
The IUPAC name of 1,3-ditert-butyl-1,3,2λ2-diazastannole (CID 154710402) is 1,3-ditert-butyl-1,3,2λ2-diazastannole.
What is the SMILES notation for 1,3-ditert-butyl-1,3,2λ2-diazastannole?
The canonical SMILES for 1,3-ditert-butyl-1,3,2λ2-diazastannole is CC(C)(C)N1C=CN(C(C)(C)C)[Sn]1.
What is the InChIKey of 1,3-ditert-butyl-1,3,2λ2-diazastannole?
The InChIKey is GMFXUCQSNQGPJG-CFYXSCKTSA-N. The full InChI is InChI=1S/C10H20N2.Sn/c1-9(2,3)11-7-8-12-10(4,5)6;/h7-8H,1-6H3;/q-2;+2/b8-7-;.
What are the key properties of 1,3-ditert-butyl-1,3,2λ2-diazastannole?
1,3-ditert-butyl-1,3,2λ2-diazastannole has a molecular weight of 287.00 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-ditert-butyl-1,3,2λ2-diazastannole is sourced from PubChem (CID 154710402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).