C20H17BFNO2 — CID 154711125
(8-fluoro-13-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-8-yl)-(4-methylphenyl)methanone (PubChem CID 154711125) has the molecular formula C20H17BFNO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is (8-fluoro-13-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-8-yl)-(4-methylphenyl)methanone.
| Compound Name | (8-fluoro-13-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-8-yl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 154711125 |
| Molecular Formula | C20H17BFNO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (8-fluoro-13-methyl-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-8-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[B-]2(F)Oc3ccc(C)cc3-c3cccc[n+]32)cc1 |
| InChI | InChI=1S/C20H17BFNO2/c1-14-6-9-16(10-7-14)20(24)21(22)23-12-4-3-5-18(23)17-13-15(2)8-11-19(17)25-21/h3-13H,1-2H3 |
| InChIKey | FGKCFRHOEWQBBD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|