C23H17BFNO2 — CID 154711126
(9-fluoro-8-oxa-10-azonia-9-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-9-yl)-(4-methylphenyl)methanone (PubChem CID 154711126) has the molecular formula C23H17BFNO2 and a molecular weight of 369.20 g/mol. Its IUPAC name is (9-fluoro-8-oxa-10-azonia-9-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-9-yl)-(4-methylphenyl)methanone.
| Compound Name | (9-fluoro-8-oxa-10-azonia-9-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-9-yl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 154711126 |
| Molecular Formula | C23H17BFNO2 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (9-fluoro-8-oxa-10-azonia-9-boranuidatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),2,4,6,11,13,15,17-octaen-9-yl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[B-]2(F)Oc3ccccc3-c3c4ccccc4cc[n+]32)cc1 |
| InChI | InChI=1S/C23H17BFNO2/c1-16-10-12-18(13-11-16)23(27)24(25)26-15-14-17-6-2-3-7-19(17)22(26)20-8-4-5-9-21(20)28-24/h2-15H,1H3 |
| InChIKey | QSWCIMBBIJIXEV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|