C48H59NO17S — CID 154711314
methyl 5-acetamido-4-acetyloxy-2-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate (PubChem CID 154711314) has the molecular formula C48H59NO17S and a molecular weight of 954.06 g/mol. Its IUPAC name is methyl 5-acetamido-4-acetyloxy-2-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate.
| Compound Name | methyl 5-acetamido-4-acetyloxy-2-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate |
|---|---|
| PubChem CID | 154711314 |
| Molecular Formula | C48H59NO17S |
| Molecular Weight | 954.06 g/mol |
| Exact Mass | 953.35 |
| IUPAC Name | methyl 5-acetamido-4-acetyloxy-2-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate |
| SMILES | COC(=O)C1(OCC2OC(OC)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)CC(OC(C)=O)C(NC(C)=O)C(C(OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)S1 |
| InChI | InChI=1S/C48H59NO17S/c1-29(50)49-40-37(63-31(3)52)23-48(47(55)57-7,67-45(40)42(65-33(5)54)38(64-32(4)53)27-58-30(2)51)62-28-39-41(59-24-34-17-11-8-12-18-34)43(60-25-35-19-13-9-14-20-35)44(46(56-6)66-39)61-26-36-21-15-10-16-22-36/h8-22,37-46H,23-28H2,1-7H3,(H,49,50)/t37?,38-,39?,40?,41?,42?,43?,44?,45?,46?,48?/m1/s1 |
| InChIKey | ZRXBAGIOQTWJHX-MRFLFNTASA-N |
| XLogP | 4.37 |
| TPSA | 215.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|