C34H45NO18S — CID 154711315
methyl 5-acetamido-4-acetyloxy-2-[(4-benzoyloxy-3,5-dihydroxy-6-methoxyoxan-2-yl)methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate (PubChem CID 154711315) has the molecular formula C34H45NO18S and a molecular weight of 787.79 g/mol. Its IUPAC name is methyl 5-acetamido-4-acetyloxy-2-[(4-benzoyloxy-3,5-dihydroxy-6-methoxyoxan-2-yl)methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate.
| Compound Name | methyl 5-acetamido-4-acetyloxy-2-[(4-benzoyloxy-3,5-dihydroxy-6-methoxyoxan-2-yl)methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate |
|---|---|
| PubChem CID | 154711315 |
| Molecular Formula | C34H45NO18S |
| Molecular Weight | 787.79 g/mol |
| Exact Mass | 787.24 |
| IUPAC Name | methyl 5-acetamido-4-acetyloxy-2-[(4-benzoyloxy-3,5-dihydroxy-6-methoxyoxan-2-yl)methoxy]-6-[(1R,2R)-1,2,3-triacetyloxypropyl]thiane-2-carboxylate |
| SMILES | COC(=O)C1(OCC2OC(OC)C(O)C(OC(=O)c3ccccc3)C2O)CC(OC(C)=O)C(NC(C)=O)C(C(OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)S1 |
| InChI | InChI=1S/C34H45NO18S/c1-16(36)35-25-22(49-18(3)38)13-34(33(44)46-7,54-30(25)28(51-20(5)40)24(50-19(4)39)14-47-17(2)37)48-15-23-26(41)29(27(42)32(45-6)52-23)53-31(43)21-11-9-8-10-12-21/h8-12,22-30,32,41-42H,13-15H2,1-7H3,(H,35,36)/t22?,23?,24-,25?,26?,27?,28?,29?,30?,32?,34?/m1/s1 |
| InChIKey | AFEFQAVGTJJXJO-KRYKGWGLSA-N |
| XLogP | -0.44 |
| TPSA | 255.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.79 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|