C16H20O — CID 154711638
(2R)-4-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-chromene (PubChem CID 154711638) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (2R)-4-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-chromene.
| Compound Name | (2R)-4-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 154711638 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2R)-4-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-chromene |
| SMILES | CC1=C2CCCCC2O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H20O/c1-12-11-16(13-7-3-2-4-8-13)17-15-10-6-5-9-14(12)15/h2-4,7-8,15-16H,5-6,9-11H2,1H3/t15?,16-/m1/s1 |
| InChIKey | UEFQPKKSECWGJM-OEMAIJDKSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|