C10H18O — CID 154711650
(2R)-4,5-dimethyl-2-propan-2-yl-3,6-dihydro-2H-pyran (PubChem CID 154711650) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2R)-4,5-dimethyl-2-propan-2-yl-3,6-dihydro-2H-pyran.
| Compound Name | (2R)-4,5-dimethyl-2-propan-2-yl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 154711650 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2R)-4,5-dimethyl-2-propan-2-yl-3,6-dihydro-2H-pyran |
| SMILES | CC1=C(C)C[C@H](C(C)C)OC1 |
| InChI | InChI=1S/C10H18O/c1-7(2)10-5-8(3)9(4)6-11-10/h7,10H,5-6H2,1-4H3/t10-/m1/s1 |
| InChIKey | DKYOLTMJEYDVEZ-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|