C18H24O3S — CID 154711754
2,2-dimethyl-4-(4-methylphenyl)sulfonyl-1-oxaspiro[4.5]dec-3-ene (PubChem CID 154711754) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is 2,2-dimethyl-4-(4-methylphenyl)sulfonyl-1-oxaspiro[4.5]dec-3-ene.
| Compound Name | 2,2-dimethyl-4-(4-methylphenyl)sulfonyl-1-oxaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 154711754 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2,2-dimethyl-4-(4-methylphenyl)sulfonyl-1-oxaspiro[4.5]dec-3-ene |
| SMILES | Cc1ccc(S(=O)(=O)C2=CC(C)(C)OC23CCCCC3)cc1 |
| InChI | InChI=1S/C18H24O3S/c1-14-7-9-15(10-8-14)22(19,20)16-13-17(2,3)21-18(16)11-5-4-6-12-18/h7-10,13H,4-6,11-12H2,1-3H3 |
| InChIKey | GVXCSYYXBSXJEM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |