C12H12F5N3O2 — CID 154711996
1-(2-azido-1-tert-butylperoxyethyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 154711996) has the molecular formula C12H12F5N3O2 and a molecular weight of 325.24 g/mol. Its IUPAC name is 1-(2-azido-1-tert-butylperoxyethyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(2-azido-1-tert-butylperoxyethyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 154711996 |
| Molecular Formula | C12H12F5N3O2 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-(2-azido-1-tert-butylperoxyethyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | CC(C)(C)OOC(CN=[N+]=[N-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5N3O2/c1-12(2,3)22-21-5(4-19-20-18)6-7(13)9(15)11(17)10(16)8(6)14/h5H,4H2,1-3H3 |
| InChIKey | WGJIQYQKWPOJHI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|