C23H46B2O5 — CID 154712174
2-[7-methoxy-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154712174) has the molecular formula C23H46B2O5 and a molecular weight of 424.24 g/mol. Its IUPAC name is 2-[7-methoxy-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[7-methoxy-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712174 |
| Molecular Formula | C23H46B2O5 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | 2-[7-methoxy-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COC(C)(C)CCCC(C)CC(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H46B2O5/c1-17(14-13-15-19(2,3)26-12)16-18(24-27-20(4,5)21(6,7)28-24)25-29-22(8,9)23(10,11)30-25/h17-18H,13-16H2,1-12H3 |
| InChIKey | HKTWBHVNIQCYSZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|