About tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane
tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane (PubChem CID 154712403) has the molecular formula C27H39NOSi
and a molecular weight of 421.70 g/mol. Its IUPAC name is tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane |
| PubChem CID | 154712403 |
| Molecular Formula | C27H39NOSi |
| Molecular Weight | 421.70 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane |
| SMILES | C=C[C@H]([C@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCCN1 |
| InChI | InChI=1S/C27H39NOSi/c1-6-25(26-18-13-20-28-26)22(2)19-21-29-30(27(3,4)5,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h6-12,14-17,22,25-26,28H,1,13,18-21H2,2-5H3/t22-,25-,26+/m1/s1 |
| InChIKey | CPHDJTJCTYPRDA-RCXJIHSJSA-N |
| XLogP | 5.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane?
The IUPAC name of tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane (CID 154712403) is tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane.
What is the SMILES notation for tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane?
The canonical SMILES for tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane is C=C[C@H]([C@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCCN1.
What is the InChIKey of tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane?
The InChIKey is CPHDJTJCTYPRDA-RCXJIHSJSA-N. The full InChI is InChI=1S/C27H39NOSi/c1-6-25(26-18-13-20-28-26)22(2)19-21-29-30(27(3,4)5,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h6-12,14-17,22,25-26,28H,1,13,18-21H2,2-5H3/t22-,25-,26+/m1/s1.
What are the key properties of tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane?
tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane has a molecular weight of 421.70 g/mol, XLogP of 5.14, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(3R,4R)-3-methyl-4-[(2S)-pyrrolidin-2-yl]hex-5-enoxy]-diphenylsilane is sourced from PubChem (CID 154712403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).