About (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene
(1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene (PubChem CID 154712602) has the molecular formula C15H15F3S
and a molecular weight of 284.35 g/mol. Its IUPAC name is (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene.
Molecular Properties
| Compound Name | (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene |
| PubChem CID | 154712602 |
| Molecular Formula | C15H15F3S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene |
| SMILES | CC(C)(C)/C=C1\SC(C(F)(F)F)=Cc2ccccc21 |
| InChI | InChI=1S/C15H15F3S/c1-14(2,3)9-12-11-7-5-4-6-10(11)8-13(19-12)15(16,17)18/h4-9H,1-3H3/b12-9- |
| InChIKey | IJSBKUULQAETOM-XFXZXTDPSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene?
The IUPAC name of (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene (CID 154712602) is (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene.
What is the SMILES notation for (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene?
The canonical SMILES for (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene is CC(C)(C)/C=C1\SC(C(F)(F)F)=Cc2ccccc21.
What is the InChIKey of (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene?
The InChIKey is IJSBKUULQAETOM-XFXZXTDPSA-N. The full InChI is InChI=1S/C15H15F3S/c1-14(2,3)9-12-11-7-5-4-6-10(11)8-13(19-12)15(16,17)18/h4-9H,1-3H3/b12-9-.
What are the key properties of (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene?
(1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene has a molecular weight of 284.35 g/mol, XLogP of 5.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(2,2-dimethylpropylidene)-3-(trifluoromethyl)isothiochromene is sourced from PubChem (CID 154712602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).