C24H41BO5Si — CID 154712672
(3Z,3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethylidene]-3a,4-dihydro-1-benzofuran-5-one (PubChem CID 154712672) has the molecular formula C24H41BO5Si and a molecular weight of 448.49 g/mol. Its IUPAC name is (3Z,3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethylidene]-3a,4-dihydro-1-benzofuran-5-one.
| Compound Name | (3Z,3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethylidene]-3a,4-dihydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 154712672 |
| Molecular Formula | C24H41BO5Si |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (3Z,3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethylidene]-3a,4-dihydro-1-benzofuran-5-one |
| SMILES | C/C(B1OC(C)(C)C(C)(C)O1)=C1\CO[C@@]2(CCO[Si](C)(C)C(C)(C)C)C=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C24H41BO5Si/c1-17(25-29-22(5,6)23(7,8)30-25)19-16-27-24(12-11-18(26)15-20(19)24)13-14-28-31(9,10)21(2,3)4/h11-12,20H,13-16H2,1-10H3/b19-17-/t20-,24+/m0/s1 |
| InChIKey | BRTBQRLOQDXUJX-UUKUBPDASA-N |
| XLogP | 5.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|