C11H20O — CID 154712744
(2S)-4,5-dimethyl-2-(2-methylpropyl)-3,6-dihydro-2H-pyran (PubChem CID 154712744) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2S)-4,5-dimethyl-2-(2-methylpropyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2S)-4,5-dimethyl-2-(2-methylpropyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 154712744 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2S)-4,5-dimethyl-2-(2-methylpropyl)-3,6-dihydro-2H-pyran |
| SMILES | CC1=C(C)C[C@H](CC(C)C)OC1 |
| InChI | InChI=1S/C11H20O/c1-8(2)5-11-6-9(3)10(4)7-12-11/h8,11H,5-7H2,1-4H3/t11-/m0/s1 |
| InChIKey | CRDBGRWUSFMNPM-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|