C18H27FO2Si — CID 154712782
tert-butyl-[[(2S,5R)-5-(4-fluorophenyl)-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane (PubChem CID 154712782) has the molecular formula C18H27FO2Si and a molecular weight of 322.50 g/mol. Its IUPAC name is tert-butyl-[[(2S,5R)-5-(4-fluorophenyl)-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5R)-5-(4-fluorophenyl)-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154712782 |
| Molecular Formula | C18H27FO2Si |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl-[[(2S,5R)-5-(4-fluorophenyl)-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane |
| SMILES | CC1=C[C@H](c2ccc(F)cc2)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H27FO2Si/c1-13-11-16(14-7-9-15(19)10-8-14)21-17(13)12-20-22(5,6)18(2,3)4/h7-11,16-17H,12H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | RSLJHRYUEZTTGQ-IAGOWNOFSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|