About 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine
5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine (PubChem CID 154712815) has the molecular formula C10H17BO2
and a molecular weight of 180.06 g/mol. Its IUPAC name is 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine.
Molecular Properties
| Compound Name | 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine |
| PubChem CID | 154712815 |
| Molecular Formula | C10H17BO2 |
| Molecular Weight | 180.06 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine |
| SMILES | OB1CC=C(C2CCCCC2)CO1 |
| InChI | InChI=1S/C10H17BO2/c12-11-7-6-10(8-13-11)9-4-2-1-3-5-9/h6,9,12H,1-5,7-8H2 |
| InChIKey | LPEOVQWDPQZQCU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine?
The IUPAC name of 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine (CID 154712815) is 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine.
What is the SMILES notation for 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine?
The canonical SMILES for 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine is OB1CC=C(C2CCCCC2)CO1.
What is the InChIKey of 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine?
The InChIKey is LPEOVQWDPQZQCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BO2/c12-11-7-6-10(8-13-11)9-4-2-1-3-5-9/h6,9,12H,1-5,7-8H2.
What are the key properties of 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine?
5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine has a molecular weight of 180.06 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-2-hydroxy-3,6-dihydrooxaborinine is sourced from PubChem (CID 154712815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).