C13H13F3OS2 — CID 154712954
(6R)-6-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran 1-oxide (PubChem CID 154712954) has the molecular formula C13H13F3OS2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (6R)-6-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran 1-oxide.
| Compound Name | (6R)-6-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran 1-oxide |
|---|---|
| PubChem CID | 154712954 |
| Molecular Formula | C13H13F3OS2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (6R)-6-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)-2,5-dihydrothiopyran 1-oxide |
| SMILES | Cc1ccc(S[C@]2(C(F)(F)F)CC=CCS2=O)cc1 |
| InChI | InChI=1S/C13H13F3OS2/c1-10-4-6-11(7-5-10)18-12(13(14,15)16)8-2-3-9-19(12)17/h2-7H,8-9H2,1H3/t12-,19?/m1/s1 |
| InChIKey | YOMGMVYRHVFPNS-ISGGMURCSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|