C29H37BF3NO3Si — CID 154712990
4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trifluoromethyl)phenyl]naphthalen-1-amine (PubChem CID 154712990) has the molecular formula C29H37BF3NO3Si and a molecular weight of 543.51 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trifluoromethyl)phenyl]naphthalen-1-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trifluoromethyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 154712990 |
| Molecular Formula | C29H37BF3NO3Si |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[2-(trifluoromethyl)phenyl]naphthalen-1-amine |
| SMILES | CC1(C)OB(c2c(-c3ccccc3C(F)(F)F)c(N)c3ccccc3c2O[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C29H37BF3NO3Si/c1-26(2,3)38(8,9)35-25-19-15-11-10-14-18(19)24(34)22(20-16-12-13-17-21(20)29(31,32)33)23(25)30-36-27(4,5)28(6,7)37-30/h10-17H,34H2,1-9H3 |
| InChIKey | UJFXUOFLEZRVIJ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|