C35H76O4Si3 — CID 154713023
(6R,12R,14S,15R)-12,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-6-ol (PubChem CID 154713023) has the molecular formula C35H76O4Si3 and a molecular weight of 645.25 g/mol. Its IUPAC name is (6R,12R,14S,15R)-12,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-6-ol.
| Compound Name | (6R,12R,14S,15R)-12,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-6-ol |
|---|---|
| PubChem CID | 154713023 |
| Molecular Formula | C35H76O4Si3 |
| Molecular Weight | 645.25 g/mol |
| Exact Mass | 644.51 |
| IUPAC Name | (6R,12R,14S,15R)-12,14,15-tris[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-6-ol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](CCCCC[C@H](O)CCCCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H76O4Si3/c1-18-20-22-25-29(36)26-23-21-24-27-30(37-40(12,13)33(3,4)5)28-32(39-42(16,17)35(9,10)11)31(19-2)38-41(14,15)34(6,7)8/h19,29-32,36H,2,18,20-28H2,1,3-17H3/t29-,30-,31-,32+/m1/s1 |
| InChIKey | LXXCZGWWJZODJL-ANLCFORVSA-N |
| XLogP | 11.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.25 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|