C23H31BO6 — CID 154713045
dimethyl 2-[2-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,3-dienyl]propanedioate (PubChem CID 154713045) has the molecular formula C23H31BO6 and a molecular weight of 414.31 g/mol. Its IUPAC name is dimethyl 2-[2-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,3-dienyl]propanedioate.
| Compound Name | dimethyl 2-[2-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,3-dienyl]propanedioate |
|---|---|
| PubChem CID | 154713045 |
| Molecular Formula | C23H31BO6 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | dimethyl 2-[2-methyl-5-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,3-dienyl]propanedioate |
| SMILES | COC(=O)C(CC(C)=C=C(Cc1ccccc1)B1OC(C)(C)C(C)(C)O1)C(=O)OC |
| InChI | InChI=1S/C23H31BO6/c1-16(14-19(20(25)27-6)21(26)28-7)13-18(15-17-11-9-8-10-12-17)24-29-22(2,3)23(4,5)30-24/h8-12,19H,14-15H2,1-7H3 |
| InChIKey | GPZNAFIYXGIOEE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|