C18H34BNO6 — CID 154713206
tert-butyl (4R)-4-[(1S)-1-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 154713206) has the molecular formula C18H34BNO6 and a molecular weight of 371.28 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1S)-1-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1S)-1-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 154713206 |
| Molecular Formula | C18H34BNO6 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | tert-butyl (4R)-4-[(1S)-1-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@@H](O)CB2OC(C)(C)C(C)(C)O2)COC1(C)C |
| InChI | InChI=1S/C18H34BNO6/c1-15(2,3)24-14(22)20-12(11-23-18(20,8)9)13(21)10-19-25-16(4,5)17(6,7)26-19/h12-13,21H,10-11H2,1-9H3/t12-,13+/m1/s1 |
| InChIKey | RIOLDFCXGOMMHJ-OLZOCXBDSA-N |
| XLogP | 2.81 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|