C16H31BO3 — CID 154713227
(1S,3R)-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-en-1-ol (PubChem CID 154713227) has the molecular formula C16H31BO3 and a molecular weight of 282.23 g/mol. Its IUPAC name is (1S,3R)-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-en-1-ol.
| Compound Name | (1S,3R)-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-en-1-ol |
|---|---|
| PubChem CID | 154713227 |
| Molecular Formula | C16H31BO3 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (1S,3R)-3,7-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-en-1-ol |
| SMILES | CC(C)=CCC[C@@H](C)C[C@@H](O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H31BO3/c1-12(2)9-8-10-13(3)11-14(18)17-19-15(4,5)16(6,7)20-17/h9,13-14,18H,8,10-11H2,1-7H3/t13-,14-/m1/s1 |
| InChIKey | VBVXHIAFZLXNSW-ZIAGYGMSSA-N |
| XLogP | 3.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|