C18H27BFNO3 — CID 154713232
N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 154713232) has the molecular formula C18H27BFNO3 and a molecular weight of 335.23 g/mol. Its IUPAC name is N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 154713232 |
| Molecular Formula | C18H27BFNO3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N[C@H](B1OC(C)(C)C(C)(C)O1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H27BFNO3/c1-16(2,3)15(22)21-14(12-8-10-13(20)11-9-12)19-23-17(4,5)18(6,7)24-19/h8-11,14H,1-7H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | XGDOGBGLHHIVJD-AWEZNQCLSA-N |
| XLogP | 3.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|