C28H37BFNO3Si — CID 154713240
4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine (PubChem CID 154713240) has the molecular formula C28H37BFNO3Si and a molecular weight of 493.50 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 154713240 |
| Molecular Formula | C28H37BFNO3Si |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
| SMILES | CC1(C)OB(c2c(-c3ccc(F)cc3)c(N)c3ccccc3c2O[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C28H37BFNO3Si/c1-26(2,3)35(8,9)32-25-21-13-11-10-12-20(21)24(31)22(18-14-16-19(30)17-15-18)23(25)29-33-27(4,5)28(6,7)34-29/h10-17H,31H2,1-9H3 |
| InChIKey | GVUXXJYSPPIMMS-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|