C21H24FNO6 — CID 154713411
dimethyl 2-fluoro-2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-naphthalen-1-ylmethyl]propanedioate (PubChem CID 154713411) has the molecular formula C21H24FNO6 and a molecular weight of 405.42 g/mol. Its IUPAC name is dimethyl 2-fluoro-2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-naphthalen-1-ylmethyl]propanedioate.
| Compound Name | dimethyl 2-fluoro-2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-naphthalen-1-ylmethyl]propanedioate |
|---|---|
| PubChem CID | 154713411 |
| Molecular Formula | C21H24FNO6 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | dimethyl 2-fluoro-2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-naphthalen-1-ylmethyl]propanedioate |
| SMILES | COC(=O)C(F)(C(=O)OC)[C@@H](NC(=O)OC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H24FNO6/c1-20(2,3)29-19(26)23-16(21(22,17(24)27-4)18(25)28-5)15-12-8-10-13-9-6-7-11-14(13)15/h6-12,16H,1-5H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | ZKKDXUGQYKQGBF-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|