C16H20OS — CID 154713564
2-heptylchromene-4-thione (PubChem CID 154713564) has the molecular formula C16H20OS and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-heptylchromene-4-thione.
| Compound Name | 2-heptylchromene-4-thione |
|---|---|
| PubChem CID | 154713564 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-heptylchromene-4-thione |
| SMILES | CCCCCCCc1cc(=S)c2ccccc2o1 |
| InChI | InChI=1S/C16H20OS/c1-2-3-4-5-6-9-13-12-16(18)14-10-7-8-11-15(14)17-13/h7-8,10-12H,2-6,9H2,1H3 |
| InChIKey | FLRNVBNUSOCNGF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|