C20H33FOSi — CID 154713770
[(2R,3R)-3-fluoro-2-phenyloxolan-2-yl]methyl-tri(propan-2-yl)silane (PubChem CID 154713770) has the molecular formula C20H33FOSi and a molecular weight of 336.57 g/mol. Its IUPAC name is [(2R,3R)-3-fluoro-2-phenyloxolan-2-yl]methyl-tri(propan-2-yl)silane.
| Compound Name | [(2R,3R)-3-fluoro-2-phenyloxolan-2-yl]methyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 154713770 |
| Molecular Formula | C20H33FOSi |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(2R,3R)-3-fluoro-2-phenyloxolan-2-yl]methyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C[C@]1(c2ccccc2)OCC[C@H]1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33FOSi/c1-15(2)23(16(3)4,17(5)6)14-20(19(21)12-13-22-20)18-10-8-7-9-11-18/h7-11,15-17,19H,12-14H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | PHCOCAXDKJURRS-WOJBJXKFSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|