methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate

C13H22FNO2 — CID 154713780

IUPACmethyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate
SMILESCOC(=O)N1CC[C@H](F)C[C@@H]1C1CCCCC1
InChIInChI=1S/C13H22FNO2/c1-17-13(16)15-8-7-11(14)9-12(15)10-5-3-2-4-6-10/h10-12H,2-9H2,1H3/t11-,12+/m0/s1
InChIKeyKRDYNERAGHVHEH-NWDGAFQWSA-N
MW243.32 g/mol
LogP3.14
Rot. Bonds1

About methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate

methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate (PubChem CID 154713780) has the molecular formula C13H22FNO2 and a molecular weight of 243.32 g/mol. Its IUPAC name is methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate.

Molecular Properties

Compound Namemethyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate
PubChem CID154713780
Molecular FormulaC13H22FNO2
Molecular Weight243.32 g/mol
Exact Mass243.16
IUPAC Namemethyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate
SMILESCOC(=O)N1CC[C@H](F)C[C@@H]1C1CCCCC1
InChIInChI=1S/C13H22FNO2/c1-17-13(16)15-8-7-11(14)9-12(15)10-5-3-2-4-6-10/h10-12H,2-9H2,1H3/t11-,12+/m0/s1
InChIKeyKRDYNERAGHVHEH-NWDGAFQWSA-N
XLogP3.14
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.32
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate?
The IUPAC name of methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate (CID 154713780) is methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate.
What is the SMILES notation for methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate?
The canonical SMILES for methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate is COC(=O)N1CC[C@H](F)C[C@@H]1C1CCCCC1.
What is the InChIKey of methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate?
The InChIKey is KRDYNERAGHVHEH-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H22FNO2/c1-17-13(16)15-8-7-11(14)9-12(15)10-5-3-2-4-6-10/h10-12H,2-9H2,1H3/t11-,12+/m0/s1.
What are the key properties of methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate?
methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate has a molecular weight of 243.32 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,4S)-2-cyclohexyl-4-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 154713780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).