C17H27FO7 — CID 154713897
[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-fluoropentanoate (PubChem CID 154713897) has the molecular formula C17H27FO7 and a molecular weight of 362.39 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-fluoropentanoate.
| Compound Name | [(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-fluoropentanoate |
|---|---|
| PubChem CID | 154713897 |
| Molecular Formula | C17H27FO7 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-fluoropentanoate |
| SMILES | CC(F)CCC(=O)O[C@H]1[C@H]([C@H]2COC(C)(C)O2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H27FO7/c1-9(18)6-7-11(19)21-13-12(10-8-20-16(2,3)23-10)22-15-14(13)24-17(4,5)25-15/h9-10,12-15H,6-8H2,1-5H3/t9?,10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | ZEZSZFPKZZIYPA-MQFOKRINSA-N |
| XLogP | 2.06 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |