C19H20F4O2S — CID 154714008
1-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]-4-(trifluoromethyl)benzene (PubChem CID 154714008) has the molecular formula C19H20F4O2S and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154714008 |
| Molecular Formula | C19H20F4O2S |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)sulfonyl-1-fluoroethyl]-4-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CC(F)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F4O2S/c1-18(2,3)14-8-10-16(11-9-14)26(24,25)12-17(20)13-4-6-15(7-5-13)19(21,22)23/h4-11,17H,12H2,1-3H3 |
| InChIKey | YGIQPHJXROFDOC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |