C48H30O12 — CID 15471410
4-[2,3,4,5,6-pentakis(4-carboxyphenyl)phenyl]benzoic acid (PubChem CID 15471410) has the molecular formula C48H30O12 and a molecular weight of 798.76 g/mol. Its IUPAC name is 4-[2,3,4,5,6-pentakis(4-carboxyphenyl)phenyl]benzoic acid.
| Compound Name | 4-[2,3,4,5,6-pentakis(4-carboxyphenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 15471410 |
| Molecular Formula | C48H30O12 |
| Molecular Weight | 798.76 g/mol |
| Exact Mass | 798.17 |
| IUPAC Name | 4-[2,3,4,5,6-pentakis(4-carboxyphenyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(-c3ccc(C(=O)O)cc3)c(-c3ccc(C(=O)O)cc3)c(-c3ccc(C(=O)O)cc3)c(-c3ccc(C(=O)O)cc3)c2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C48H30O12/c49-43(50)31-13-1-25(2-14-31)37-38(26-3-15-32(16-4-26)44(51)52)40(28-7-19-34(20-8-28)46(55)56)42(30-11-23-36(24-12-30)48(59)60)41(29-9-21-35(22-10-29)47(57)58)39(37)27-5-17-33(18-6-27)45(53)54/h1-24H,(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | LUIFAWBWDOLINT-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.76 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |