About (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one
(5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one (PubChem CID 154714117) has the molecular formula C16H12FNO2
and a molecular weight of 269.28 g/mol. Its IUPAC name is (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one |
| PubChem CID | 154714117 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one |
| SMILES | O=C1OC(c2ccccc2)=NC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FNO2/c17-13-8-6-11(7-9-13)14-10-18-15(20-16(14)19)12-4-2-1-3-5-12/h1-9,14H,10H2/t14-/m1/s1 |
| InChIKey | FSRJJMZVJQXQEH-CQSZACIVSA-N |
| XLogP | 2.91 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one?
The IUPAC name of (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one (CID 154714117) is (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one.
What is the SMILES notation for (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one?
The canonical SMILES for (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one is O=C1OC(c2ccccc2)=NC[C@@H]1c1ccc(F)cc1.
What is the InChIKey of (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one?
The InChIKey is FSRJJMZVJQXQEH-CQSZACIVSA-N. The full InChI is InChI=1S/C16H12FNO2/c17-13-8-6-11(7-9-13)14-10-18-15(20-16(14)19)12-4-2-1-3-5-12/h1-9,14H,10H2/t14-/m1/s1.
What are the key properties of (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one?
(5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one has a molecular weight of 269.28 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(4-fluorophenyl)-2-phenyl-4,5-dihydro-1,3-oxazin-6-one is sourced from PubChem (CID 154714117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).