C30H36N4 — CID 15471419
2-ethynyl-5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 15471419) has the molecular formula C30H36N4 and a molecular weight of 452.65 g/mol. Its IUPAC name is 2-ethynyl-5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 2-ethynyl-5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 15471419 |
| Molecular Formula | C30H36N4 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 2-ethynyl-5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | C#Cc1cc2[nH]c1C(C)(C)c1ccc([nH]1)C(C)(C)c1ccc([nH]1)C(C)(C)c1ccc([nH]1)C2(C)C |
| InChI | InChI=1S/C30H36N4/c1-10-18-17-25-29(6,7)23-14-13-21(32-23)27(2,3)19-11-12-20(31-19)28(4,5)22-15-16-24(33-22)30(8,9)26(18)34-25/h1,11-17,31-34H,2-9H3 |
| InChIKey | UBOQNPNITABVFJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|