C20H20FNO2 — CID 154714287
(4aS,10bR)-4a-fluoro-5,5,9-trimethyl-2-phenyl-4,10b-dihydrochromeno[3,4-e][1,3]oxazine (PubChem CID 154714287) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is (4aS,10bR)-4a-fluoro-5,5,9-trimethyl-2-phenyl-4,10b-dihydrochromeno[3,4-e][1,3]oxazine.
| Compound Name | (4aS,10bR)-4a-fluoro-5,5,9-trimethyl-2-phenyl-4,10b-dihydrochromeno[3,4-e][1,3]oxazine |
|---|---|
| PubChem CID | 154714287 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (4aS,10bR)-4a-fluoro-5,5,9-trimethyl-2-phenyl-4,10b-dihydrochromeno[3,4-e][1,3]oxazine |
| SMILES | Cc1ccc2c(c1)[C@H]1OC(c3ccccc3)=NC[C@@]1(F)C(C)(C)O2 |
| InChI | InChI=1S/C20H20FNO2/c1-13-9-10-16-15(11-13)17-20(21,19(2,3)24-16)12-22-18(23-17)14-7-5-4-6-8-14/h4-11,17H,12H2,1-3H3/t17-,20+/m1/s1 |
| InChIKey | VKPCZIZFTABZFE-XLIONFOSSA-N |
| XLogP | 4.39 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |