C22H16F5NO2 — CID 154714316
(2,3,4,5,6-pentafluorophenyl) (2R)-2-(1-benzylpyrrol-2-yl)pent-4-enoate (PubChem CID 154714316) has the molecular formula C22H16F5NO2 and a molecular weight of 421.37 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2R)-2-(1-benzylpyrrol-2-yl)pent-4-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2R)-2-(1-benzylpyrrol-2-yl)pent-4-enoate |
|---|---|
| PubChem CID | 154714316 |
| Molecular Formula | C22H16F5NO2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2R)-2-(1-benzylpyrrol-2-yl)pent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)Oc1c(F)c(F)c(F)c(F)c1F)c1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C22H16F5NO2/c1-2-7-14(15-10-6-11-28(15)12-13-8-4-3-5-9-13)22(29)30-21-19(26)17(24)16(23)18(25)20(21)27/h2-6,8-11,14H,1,7,12H2/t14-/m1/s1 |
| InChIKey | VSZZYOLFHIVZIK-CQSZACIVSA-N |
| XLogP | 5.50 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|