C15H18ClFO — CID 154714467
(1S,4aS,8aS)-1-(4-chlorophenyl)-6-fluoro-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene (PubChem CID 154714467) has the molecular formula C15H18ClFO and a molecular weight of 268.76 g/mol. Its IUPAC name is (1S,4aS,8aS)-1-(4-chlorophenyl)-6-fluoro-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene.
| Compound Name | (1S,4aS,8aS)-1-(4-chlorophenyl)-6-fluoro-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
|---|---|
| PubChem CID | 154714467 |
| Molecular Formula | C15H18ClFO |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (1S,4aS,8aS)-1-(4-chlorophenyl)-6-fluoro-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromene |
| SMILES | FC1CC[C@H]2[C@@H](CCO[C@@H]2c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H18ClFO/c16-12-3-1-10(2-4-12)15-14-6-5-13(17)9-11(14)7-8-18-15/h1-4,11,13-15H,5-9H2/t11-,13?,14-,15+/m0/s1 |
| InChIKey | VJVPOVXWLUJATF-PRTUASRFSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |