C13H12Cl2FNO — CID 154714583
(3aS,5R,6R,6aR)-2-(3,5-dichlorophenyl)-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole (PubChem CID 154714583) has the molecular formula C13H12Cl2FNO and a molecular weight of 288.15 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-2-(3,5-dichlorophenyl)-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole.
| Compound Name | (3aS,5R,6R,6aR)-2-(3,5-dichlorophenyl)-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
|---|---|
| PubChem CID | 154714583 |
| Molecular Formula | C13H12Cl2FNO |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | (3aS,5R,6R,6aR)-2-(3,5-dichlorophenyl)-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
| SMILES | C[C@@H]1[C@H]2OC(c3cc(Cl)cc(Cl)c3)=N[C@H]2C[C@H]1F |
| InChI | InChI=1S/C13H12Cl2FNO/c1-6-10(16)5-11-12(6)18-13(17-11)7-2-8(14)4-9(15)3-7/h2-4,6,10-12H,5H2,1H3/t6-,10+,11-,12+/m0/s1 |
| InChIKey | JHZZEADLTDVPHA-ODQYCLEESA-N |
| XLogP | 3.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |