C11H12FNO2 — CID 154714638
(3aS,5R,6R,6aR)-5-fluoro-2-(furan-2-yl)-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole (PubChem CID 154714638) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-5-fluoro-2-(furan-2-yl)-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole.
| Compound Name | (3aS,5R,6R,6aR)-5-fluoro-2-(furan-2-yl)-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
|---|---|
| PubChem CID | 154714638 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (3aS,5R,6R,6aR)-5-fluoro-2-(furan-2-yl)-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
| SMILES | C[C@@H]1[C@H]2OC(c3ccco3)=N[C@H]2C[C@H]1F |
| InChI | InChI=1S/C11H12FNO2/c1-6-7(12)5-8-10(6)15-11(13-8)9-3-2-4-14-9/h2-4,6-8,10H,5H2,1H3/t6-,7+,8-,10+/m0/s1 |
| InChIKey | TYZMYHJNBGHHHF-PYHGXSLLSA-N |
| XLogP | 2.17 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |