C14H16FNO — CID 154714900
(3aS,5R,6R,6aR)-2-benzyl-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole (PubChem CID 154714900) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-2-benzyl-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole.
| Compound Name | (3aS,5R,6R,6aR)-2-benzyl-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
|---|---|
| PubChem CID | 154714900 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (3aS,5R,6R,6aR)-2-benzyl-5-fluoro-6-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazole |
| SMILES | C[C@@H]1[C@H]2OC(Cc3ccccc3)=N[C@H]2C[C@H]1F |
| InChI | InChI=1S/C14H16FNO/c1-9-11(15)8-12-14(9)17-13(16-12)7-10-5-3-2-4-6-10/h2-6,9,11-12,14H,7-8H2,1H3/t9-,11+,12-,14+/m0/s1 |
| InChIKey | ZNYLIUVGOCUVDB-WSXWTOPLSA-N |
| XLogP | 2.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |