C22H29BN2O5 — CID 154714960
methyl (4S)-4-acetamido-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanoate (PubChem CID 154714960) has the molecular formula C22H29BN2O5 and a molecular weight of 412.30 g/mol. Its IUPAC name is methyl (4S)-4-acetamido-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanoate.
| Compound Name | methyl (4S)-4-acetamido-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanoate |
|---|---|
| PubChem CID | 154714960 |
| Molecular Formula | C22H29BN2O5 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | methyl (4S)-4-acetamido-4-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]butanoate |
| SMILES | COC(=O)CC[C@H](NC(C)=O)c1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C22H29BN2O5/c1-14(26)24-18(11-12-20(27)28-6)19-9-7-15-13-16(8-10-17(15)25-19)23-29-21(2,3)22(4,5)30-23/h7-10,13,18H,11-12H2,1-6H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | AKJFHXSGEACXSS-SFHVURJKSA-N |
| XLogP | 2.66 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|