About (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine
(4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine (PubChem CID 154715023) has the molecular formula C16H13F2NO
and a molecular weight of 273.28 g/mol. Its IUPAC name is (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine.
Molecular Properties
| Compound Name | (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine |
| PubChem CID | 154715023 |
| Molecular Formula | C16H13F2NO |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine |
| SMILES | C[C@]1(F)Cc2cc(F)ccc2N=C(c2ccccc2)O1 |
| InChI | InChI=1S/C16H13F2NO/c1-16(18)10-12-9-13(17)7-8-14(12)19-15(20-16)11-5-3-2-4-6-11/h2-9H,10H2,1H3/t16-/m1/s1 |
| InChIKey | YHCQZDWMDZRGJE-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine?
The IUPAC name of (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine (CID 154715023) is (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine.
What is the SMILES notation for (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine?
The canonical SMILES for (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine is C[C@]1(F)Cc2cc(F)ccc2N=C(c2ccccc2)O1.
What is the InChIKey of (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine?
The InChIKey is YHCQZDWMDZRGJE-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H13F2NO/c1-16(18)10-12-9-13(17)7-8-14(12)19-15(20-16)11-5-3-2-4-6-11/h2-9H,10H2,1H3/t16-/m1/s1.
What are the key properties of (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine?
(4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine has a molecular weight of 273.28 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,7-difluoro-4-methyl-2-phenyl-5H-3,1-benzoxazepine is sourced from PubChem (CID 154715023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).