About 5-fluorohexyl naphthalene-2-carboxylate
5-fluorohexyl naphthalene-2-carboxylate (PubChem CID 154715027) has the molecular formula C17H19FO2
and a molecular weight of 274.34 g/mol. Its IUPAC name is 5-fluorohexyl naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | 5-fluorohexyl naphthalene-2-carboxylate |
| PubChem CID | 154715027 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-fluorohexyl naphthalene-2-carboxylate |
| SMILES | CC(F)CCCCOC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H19FO2/c1-13(18)6-4-5-11-20-17(19)16-10-9-14-7-2-3-8-15(14)12-16/h2-3,7-10,12-13H,4-6,11H2,1H3 |
| InChIKey | CMTQRODAAMBESL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluorohexyl naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorohexyl naphthalene-2-carboxylate?
The IUPAC name of 5-fluorohexyl naphthalene-2-carboxylate (CID 154715027) is 5-fluorohexyl naphthalene-2-carboxylate.
What is the SMILES notation for 5-fluorohexyl naphthalene-2-carboxylate?
The canonical SMILES for 5-fluorohexyl naphthalene-2-carboxylate is CC(F)CCCCOC(=O)c1ccc2ccccc2c1.
What is the InChIKey of 5-fluorohexyl naphthalene-2-carboxylate?
The InChIKey is CMTQRODAAMBESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FO2/c1-13(18)6-4-5-11-20-17(19)16-10-9-14-7-2-3-8-15(14)12-16/h2-3,7-10,12-13H,4-6,11H2,1H3.
What are the key properties of 5-fluorohexyl naphthalene-2-carboxylate?
5-fluorohexyl naphthalene-2-carboxylate has a molecular weight of 274.34 g/mol, XLogP of 4.52, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorohexyl naphthalene-2-carboxylate is sourced from PubChem (CID 154715027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).