About 3-fluorobutyl naphthalene-2-carboxylate
3-fluorobutyl naphthalene-2-carboxylate (PubChem CID 154715188) has the molecular formula C15H15FO2
and a molecular weight of 246.28 g/mol. Its IUPAC name is 3-fluorobutyl naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | 3-fluorobutyl naphthalene-2-carboxylate |
| PubChem CID | 154715188 |
| Molecular Formula | C15H15FO2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-fluorobutyl naphthalene-2-carboxylate |
| SMILES | CC(F)CCOC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H15FO2/c1-11(16)8-9-18-15(17)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | RUIGFIQWTPCSLN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluorobutyl naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobutyl naphthalene-2-carboxylate?
The IUPAC name of 3-fluorobutyl naphthalene-2-carboxylate (CID 154715188) is 3-fluorobutyl naphthalene-2-carboxylate.
What is the SMILES notation for 3-fluorobutyl naphthalene-2-carboxylate?
The canonical SMILES for 3-fluorobutyl naphthalene-2-carboxylate is CC(F)CCOC(=O)c1ccc2ccccc2c1.
What is the InChIKey of 3-fluorobutyl naphthalene-2-carboxylate?
The InChIKey is RUIGFIQWTPCSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FO2/c1-11(16)8-9-18-15(17)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10-11H,8-9H2,1H3.
What are the key properties of 3-fluorobutyl naphthalene-2-carboxylate?
3-fluorobutyl naphthalene-2-carboxylate has a molecular weight of 246.28 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobutyl naphthalene-2-carboxylate is sourced from PubChem (CID 154715188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).