C22H27FO3S — CID 154715284
(5R,6S)-5-(4-tert-butylphenyl)sulfonyl-6-fluoro-6-phenylhexan-2-one (PubChem CID 154715284) has the molecular formula C22H27FO3S and a molecular weight of 390.52 g/mol. Its IUPAC name is (5R,6S)-5-(4-tert-butylphenyl)sulfonyl-6-fluoro-6-phenylhexan-2-one.
| Compound Name | (5R,6S)-5-(4-tert-butylphenyl)sulfonyl-6-fluoro-6-phenylhexan-2-one |
|---|---|
| PubChem CID | 154715284 |
| Molecular Formula | C22H27FO3S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (5R,6S)-5-(4-tert-butylphenyl)sulfonyl-6-fluoro-6-phenylhexan-2-one |
| SMILES | CC(=O)CC[C@H]([C@@H](F)c1ccccc1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H27FO3S/c1-16(24)10-15-20(21(23)17-8-6-5-7-9-17)27(25,26)19-13-11-18(12-14-19)22(2,3)4/h5-9,11-14,20-21H,10,15H2,1-4H3/t20-,21+/m1/s1 |
| InChIKey | VNMCJHHLZZSPSV-RTWAWAEBSA-N |
| XLogP | 5.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |