C21H17ClF3NO2 — CID 154715342
(2S,3R)-6-chloro-3-[4-(trifluoromethyl)anilino]spiro[3H-indene-2,2'-cyclohexane]-1,1'-dione (PubChem CID 154715342) has the molecular formula C21H17ClF3NO2 and a molecular weight of 407.82 g/mol. Its IUPAC name is (2S,3R)-6-chloro-3-[4-(trifluoromethyl)anilino]spiro[3H-indene-2,2'-cyclohexane]-1,1'-dione.
| Compound Name | (2S,3R)-6-chloro-3-[4-(trifluoromethyl)anilino]spiro[3H-indene-2,2'-cyclohexane]-1,1'-dione |
|---|---|
| PubChem CID | 154715342 |
| Molecular Formula | C21H17ClF3NO2 |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (2S,3R)-6-chloro-3-[4-(trifluoromethyl)anilino]spiro[3H-indene-2,2'-cyclohexane]-1,1'-dione |
| SMILES | O=C1CCCC[C@@]12C(=O)c1cc(Cl)ccc1[C@H]2Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17ClF3NO2/c22-13-6-9-15-16(11-13)19(28)20(10-2-1-3-17(20)27)18(15)26-14-7-4-12(5-8-14)21(23,24)25/h4-9,11,18,26H,1-3,10H2/t18-,20-/m1/s1 |
| InChIKey | YSBCJEHJBSXALE-UYAOXDASSA-N |
| XLogP | 5.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|