About 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile
2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile (PubChem CID 154715400) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile |
| PubChem CID | 154715400 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile |
| SMILES | N#CC[C@H]1CCC[C@@]1(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H17NO/c18-11-9-15-6-3-10-17(15,19)16-8-7-13-4-1-2-5-14(13)12-16/h1-2,4-5,7-8,12,15,19H,3,6,9-10H2/t15-,17+/m1/s1 |
| InChIKey | FMEMAVLGXWLJSE-WBVHZDCISA-N |
| XLogP | 3.74 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile?
The IUPAC name of 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile (CID 154715400) is 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile.
What is the SMILES notation for 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile?
The canonical SMILES for 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile is N#CC[C@H]1CCC[C@@]1(O)c1ccc2ccccc2c1.
What is the InChIKey of 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile?
The InChIKey is FMEMAVLGXWLJSE-WBVHZDCISA-N. The full InChI is InChI=1S/C17H17NO/c18-11-9-15-6-3-10-17(15,19)16-8-7-13-4-1-2-5-14(13)12-16/h1-2,4-5,7-8,12,15,19H,3,6,9-10H2/t15-,17+/m1/s1.
What are the key properties of 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile?
2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile has a molecular weight of 251.33 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-2-hydroxy-2-naphthalen-2-ylcyclopentyl]acetonitrile is sourced from PubChem (CID 154715400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).